![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Descr.WD3 | 2010-09-21 22:34 | 3.0K | |
| loader.htm | 2010-10-02 22:35 | 11K | |
| 5-2.pdf | 2010-09-21 22:25 | 81K | |
| 0-1 FORWORD.pdf | 2010-09-21 22:24 | 331K | |
| 7-4. Electrical component.pdf | 2010-09-21 22:26 | 359K | |
| 1-3 Operational check.pdf | 2010-09-21 22:24 | 384K | |
| 4-4 disassembly and assembly.pdf | 2010-09-21 22:25 | 417K | |
| 4-2. operation check.pdf | 2010-09-21 22:25 | 429K | |
| 3-2. Operation check.pdf | 2010-09-21 22:24 | 429K | |
| 1-1 Safety hint.pdf | 2010-09-21 22:24 | 439K | |
| 3-3. Tests and Adjustments.pdf | 2010-09-21 22:24 | 440K | |
| 4-3. test and adjustment.pdf | 2010-09-21 22:25 | 474K | |
| 5-3.pdf | 2010-09-21 22:25 | 515K | |
| 5-1.pdf | 2010-09-21 22:25 | 519K | |
| 7-2. Electrical circuit_A2_.pdf | 2010-09-21 22:25 | 548K | |
| 6-3. test and adjustment.pdf | 2010-09-21 22:25 | 588K | |
| 7-3. Monitoring system.pdf | 2010-09-21 22:25 | 589K | |
| 2-1 Engine.pdf | 2010-09-21 22:24 | 613K | |
| 4-1. structure and function.pdf | 2010-09-21 22:25 | 671K | |
| 6-2. operation check.pdf | 2010-09-21 22:25 | 679K | |
| 1-2 Specificaiton.pdf | 2010-09-21 22:24 | 763K | |
| 7-5.pdf | 2010-09-21 22:26 | 772K | |
| 7-6.pdf | 2010-09-21 22:26 | 788K | |
| 6-4. assembly and disassembly.pdf | 2010-09-21 22:25 | 896K | |
| 6-1. structure and function.pdf | 2010-09-21 22:25 | 1.1M | |
| 7-1.pdf | 2010-09-21 22:25 | 1.1M | |
| 5-4 disassembly and assembly.pdf | 2010-09-21 22:25 | 1.2M | |
| 3-1.pdf | 2010-09-21 22:24 | 1.7M | |
| 3-4.pdf.primary | 2010-09-21 22:34 | 93M | |